C20H23ClN4O3 — CID 2975510
N-(2,5-dimethoxyphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride (PubChem CID 2975510) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 2975510 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride |
| SMILES | COc1ccc(OC)c(Nc2nc(N3CCOCC3)c3ccccc3n2)c1.Cl |
| InChI | InChI=1S/C20H22N4O3.ClH/c1-25-14-7-8-18(26-2)17(13-14)22-20-21-16-6-4-3-5-15(16)19(23-20)24-9-11-27-12-10-24;/h3-8,13H,9-12H2,1-2H3,(H,21,22,23);1H |
| InChIKey | FFYVFCMCCSYGSX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |