C19H21ClN4O — CID 2910267
N-(4-methylphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride (PubChem CID 2910267) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride.
| Compound Name | N-(4-methylphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 2910267 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-(4-methylphenyl)-4-morpholin-4-ylquinazolin-2-amine;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(N3CCOCC3)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C19H20N4O.ClH/c1-14-6-8-15(9-7-14)20-19-21-17-5-3-2-4-16(17)18(22-19)23-10-12-24-13-11-23;/h2-9H,10-13H2,1H3,(H,20,21,22);1H |
| InChIKey | MXCNJXGKKJKZAJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |