C19H21N5O — CID 769532
4-[[4-(4-methylpiperazin-1-yl)quinazolin-2-yl]amino]phenol (PubChem CID 769532) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-[[4-(4-methylpiperazin-1-yl)quinazolin-2-yl]amino]phenol.
| Compound Name | 4-[[4-(4-methylpiperazin-1-yl)quinazolin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 769532 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-[[4-(4-methylpiperazin-1-yl)quinazolin-2-yl]amino]phenol |
| SMILES | CN1CCN(c2nc(Nc3ccc(O)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C19H21N5O/c1-23-10-12-24(13-11-23)18-16-4-2-3-5-17(16)21-19(22-18)20-14-6-8-15(25)9-7-14/h2-9,25H,10-13H2,1H3,(H,20,21,22) |
| InChIKey | VTHMRLOUPKJVSL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|