C18H20N6O — CID 139891033
2-anilino-4-(4-methylpiperazin-1-yl)-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 139891033) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-anilino-4-(4-methylpiperazin-1-yl)-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-anilino-4-(4-methylpiperazin-1-yl)-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 139891033 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-anilino-4-(4-methylpiperazin-1-yl)-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2nc(Nc3ccccc3)nc3[nH]c(=O)ccc23)CC1 |
| InChI | InChI=1S/C18H20N6O/c1-23-9-11-24(12-10-23)17-14-7-8-15(25)20-16(14)21-18(22-17)19-13-5-3-2-4-6-13/h2-8H,9-12H2,1H3,(H2,19,20,21,22,25) |
| InChIKey | OHKGUBMWUXPABR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |