C24H27N7O — CID 140608262
4-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-8H-pyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 140608262) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 4-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-8H-pyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 4-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-8H-pyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 140608262 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 4-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]-7-oxo-8H-pyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | CN1CCN(c2ccc(Nc3nc(C4CCCC4)c4cc(C#N)c(=O)[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C24H27N7O/c1-30-10-12-31(13-11-30)19-8-6-18(7-9-19)26-24-27-21(16-4-2-3-5-16)20-14-17(15-25)23(32)28-22(20)29-24/h6-9,14,16H,2-5,10-13H2,1H3,(H2,26,27,28,29,32) |
| InChIKey | RUCAKJWZNHWAKW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|