C24H31N7O2 — CID 175901632
4-[(2-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbaldehyde (PubChem CID 175901632) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 4-[(2-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbaldehyde.
| Compound Name | 4-[(2-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 175901632 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 4-[(2-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidine-5-carbaldehyde |
| SMILES | CN1CCN(c2ccc(Nc3nc(NC4CCCCC4O)c4c(C=O)c[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C24H31N7O2/c1-30-10-12-31(13-11-30)18-8-6-17(7-9-18)26-24-28-22-21(16(15-32)14-25-22)23(29-24)27-19-4-2-3-5-20(19)33/h6-9,14-15,19-20,33H,2-5,10-13H2,1H3,(H3,25,26,27,28,29) |
| InChIKey | VVYWLKYTTXDQLT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|