C32H42N8O2 — CID 168769391
5-[[(1R,2R)-2-hydroxycyclopentyl]amino]-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpyrazine-2-carboxamide (PubChem CID 168769391) has the molecular formula C32H42N8O2 and a molecular weight of 570.74 g/mol. Its IUPAC name is 5-[[(1R,2R)-2-hydroxycyclopentyl]amino]-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpyrazine-2-carboxamide.
| Compound Name | 5-[[(1R,2R)-2-hydroxycyclopentyl]amino]-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769391 |
| Molecular Formula | C32H42N8O2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | 5-[[(1R,2R)-2-hydroxycyclopentyl]amino]-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenylpyrazine-2-carboxamide |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4nc(N[C@@H]5CCC[C@H]5O)c(-c5ccccc5)nc4C(N)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C32H42N8O2/c1-38-18-20-40(21-19-38)25-14-16-39(17-15-25)24-12-10-23(11-13-24)34-32-29(30(33)42)36-28(22-6-3-2-4-7-22)31(37-32)35-26-8-5-9-27(26)41/h2-4,6-7,10-13,25-27,41H,5,8-9,14-21H2,1H3,(H2,33,42)(H2,34,35,37)/t26-,27-/m1/s1 |
| InChIKey | HDSWOHHTXFTFGF-KAYWLYCHSA-N |
| XLogP | 3.53 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|