C30H38N8OS — CID 168769194
3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenyl-5-(thietan-3-ylamino)pyrazine-2-carboxamide (PubChem CID 168769194) has the molecular formula C30H38N8OS and a molecular weight of 558.76 g/mol. Its IUPAC name is 3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenyl-5-(thietan-3-ylamino)pyrazine-2-carboxamide.
| Compound Name | 3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenyl-5-(thietan-3-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769194 |
| Molecular Formula | C30H38N8OS |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-6-phenyl-5-(thietan-3-ylamino)pyrazine-2-carboxamide |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4nc(NC5CSC5)c(-c5ccccc5)nc4C(N)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C30H38N8OS/c1-36-15-17-38(18-16-36)25-11-13-37(14-12-25)24-9-7-22(8-10-24)32-30-27(28(31)39)34-26(21-5-3-2-4-6-21)29(35-30)33-23-19-40-20-23/h2-10,23,25H,11-20H2,1H3,(H2,31,39)(H2,32,33,35) |
| InChIKey | KLNAQZPCSSZKNO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|