C27H38N10O — CID 168769499
3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(propan-2-ylamino)-6-(1H-pyrazol-5-yl)pyrazine-2-carboxamide (PubChem CID 168769499) has the molecular formula C27H38N10O and a molecular weight of 518.67 g/mol. Its IUPAC name is 3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(propan-2-ylamino)-6-(1H-pyrazol-5-yl)pyrazine-2-carboxamide.
| Compound Name | 3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(propan-2-ylamino)-6-(1H-pyrazol-5-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769499 |
| Molecular Formula | C27H38N10O |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | 3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(propan-2-ylamino)-6-(1H-pyrazol-5-yl)pyrazine-2-carboxamide |
| SMILES | CC(C)Nc1nc(Nc2ccc(N3CCC(N4CCN(C)CC4)CC3)cc2)c(C(N)=O)nc1-c1ccn[nH]1 |
| InChI | InChI=1S/C27H38N10O/c1-18(2)30-26-23(22-8-11-29-34-22)32-24(25(28)38)27(33-26)31-19-4-6-20(7-5-19)36-12-9-21(10-13-36)37-16-14-35(3)15-17-37/h4-8,11,18,21H,9-10,12-17H2,1-3H3,(H2,28,38)(H,29,34)(H2,30,31,33) |
| InChIKey | ZSMSTACCXRDENW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|