C33H41N9O — CID 168769346
5-(cyclobutylamino)-6-(1H-indol-4-yl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrazine-2-carboxamide (PubChem CID 168769346) has the molecular formula C33H41N9O and a molecular weight of 579.75 g/mol. Its IUPAC name is 5-(cyclobutylamino)-6-(1H-indol-4-yl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrazine-2-carboxamide.
| Compound Name | 5-(cyclobutylamino)-6-(1H-indol-4-yl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769346 |
| Molecular Formula | C33H41N9O |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | 5-(cyclobutylamino)-6-(1H-indol-4-yl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrazine-2-carboxamide |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4nc(NC5CCC5)c(-c5cccc6[nH]ccc56)nc4C(N)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C33H41N9O/c1-40-18-20-42(21-19-40)25-13-16-41(17-14-25)24-10-8-23(9-11-24)37-33-30(31(34)43)38-29(32(39-33)36-22-4-2-5-22)27-6-3-7-28-26(27)12-15-35-28/h3,6-12,15,22,25,35H,2,4-5,13-14,16-21H2,1H3,(H2,34,43)(H2,36,37,39) |
| InChIKey | KMVJDSGXHHYGQC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|