C33H41N9O2 — CID 168769280
6-(4-cyanophenyl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide (PubChem CID 168769280) has the molecular formula C33H41N9O2 and a molecular weight of 595.75 g/mol. Its IUPAC name is 6-(4-cyanophenyl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide.
| Compound Name | 6-(4-cyanophenyl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769280 |
| Molecular Formula | C33H41N9O2 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | 6-(4-cyanophenyl)-3-[4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)pyrazine-2-carboxamide |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4nc(NC5CCOCC5)c(-c5ccc(C#N)cc5)nc4C(N)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C33H41N9O2/c1-40-16-18-42(19-17-40)28-10-14-41(15-11-28)27-8-6-25(7-9-27)36-33-30(31(35)43)38-29(24-4-2-23(22-34)3-5-24)32(39-33)37-26-12-20-44-21-13-26/h2-9,26,28H,10-21H2,1H3,(H2,35,43)(H2,36,37,39) |
| InChIKey | LSVOTGLNDIYSGN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 135.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|