C33H43N9O2 — CID 168769034
3-[4-[4-(4-cyclopropylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)-6-pyridin-2-ylpyrazine-2-carboxamide (PubChem CID 168769034) has the molecular formula C33H43N9O2 and a molecular weight of 597.77 g/mol. Its IUPAC name is 3-[4-[4-(4-cyclopropylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)-6-pyridin-2-ylpyrazine-2-carboxamide.
| Compound Name | 3-[4-[4-(4-cyclopropylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)-6-pyridin-2-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168769034 |
| Molecular Formula | C33H43N9O2 |
| Molecular Weight | 597.77 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | 3-[4-[4-(4-cyclopropylpiperazin-1-yl)piperidin-1-yl]anilino]-5-(oxan-4-ylamino)-6-pyridin-2-ylpyrazine-2-carboxamide |
| SMILES | NC(=O)c1nc(-c2ccccn2)c(NC2CCOCC2)nc1Nc1ccc(N2CCC(N3CCN(C4CC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C33H43N9O2/c34-31(43)30-33(39-32(37-24-12-21-44-22-13-24)29(38-30)28-3-1-2-14-35-28)36-23-4-6-25(7-5-23)40-15-10-27(11-16-40)42-19-17-41(18-20-42)26-8-9-26/h1-7,14,24,26-27H,8-13,15-22H2,(H2,34,43)(H2,36,37,39) |
| InChIKey | LGCVEBXGYNWEOA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|