C27H35ClN8O — CID 151179692
1-[(3R)-3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-2-yn-1-ol (PubChem CID 151179692) has the molecular formula C27H35ClN8O and a molecular weight of 523.09 g/mol. Its IUPAC name is 1-[(3R)-3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-2-yn-1-ol.
| Compound Name | 1-[(3R)-3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-2-yn-1-ol |
|---|---|
| PubChem CID | 151179692 |
| Molecular Formula | C27H35ClN8O |
| Molecular Weight | 523.09 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 1-[(3R)-3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]pent-2-yn-1-ol |
| SMILES | CCC#CC(O)N1CCC[C@@H](Nc2nc(Nc3ccc(N4CCN(C)CC4)cc3)nc3[nH]cc(Cl)c23)C1 |
| InChI | InChI=1S/C27H35ClN8O/c1-3-4-7-23(37)36-12-5-6-20(18-36)30-26-24-22(28)17-29-25(24)32-27(33-26)31-19-8-10-21(11-9-19)35-15-13-34(2)14-16-35/h8-11,17,20,23,37H,3,5-6,12-16,18H2,1-2H3,(H3,29,30,31,32,33)/t20-,23?/m1/s1 |
| InChIKey | NEAMDMVEMJJVHV-PPUHSXQSSA-N |
| XLogP | 3.71 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.09 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|