C26H29N7O2 — CID 171546287
cyclopentyl N-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]carbamate (PubChem CID 171546287) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is cyclopentyl N-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]carbamate.
| Compound Name | cyclopentyl N-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]carbamate |
|---|---|
| PubChem CID | 171546287 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | cyclopentyl N-[5-ethynyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-yl]carbamate |
| SMILES | C#Cc1cc(NC(=O)OC2CCCC2)nc2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc12 |
| InChI | InChI=1S/C26H29N7O2/c1-3-18-16-23(30-26(34)35-21-6-4-5-7-21)29-24-22(18)17-27-25(31-24)28-19-8-10-20(11-9-19)33-14-12-32(2)13-15-33/h1,8-11,16-17,21H,4-7,12-15H2,2H3,(H2,27,28,29,30,31,34) |
| InChIKey | XDYPVAXQSZQGPI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|