C35H50N8O2Si — CID 171546226
1-(3-methyloxolan-3-yl)-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 171546226) has the molecular formula C35H50N8O2Si and a molecular weight of 642.93 g/mol. Its IUPAC name is 1-(3-methyloxolan-3-yl)-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-(3-methyloxolan-3-yl)-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 171546226 |
| Molecular Formula | C35H50N8O2Si |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.38 |
| IUPAC Name | 1-(3-methyloxolan-3-yl)-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CC(C)[Si](C#Cc1cc(NC(=O)NC2(C)CCOC2)nc2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H50N8O2Si/c1-24(2)46(25(3)4,26(5)6)20-13-27-21-31(39-34(44)41-35(7)14-19-45-23-35)38-32-30(27)22-36-33(40-32)37-28-9-11-29(12-10-28)43-17-15-42(8)16-18-43/h9-12,21-22,24-26H,14-19,23H2,1-8H3,(H3,36,37,38,39,40,41,44) |
| InChIKey | WLUOYKKFISJBQP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|