C26H39N5OSSi — CID 171546357
1-(cyclopentylmethyl)-3-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 171546357) has the molecular formula C26H39N5OSSi and a molecular weight of 497.79 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-3-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-(cyclopentylmethyl)-3-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 171546357 |
| Molecular Formula | C26H39N5OSSi |
| Molecular Weight | 497.79 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 1-(cyclopentylmethyl)-3-[2-methylsulfanyl-5-[2-tri(propan-2-yl)silylethynyl]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CSc1ncc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(NC(=O)NCC3CCCC3)nc2n1 |
| InChI | InChI=1S/C26H39N5OSSi/c1-17(2)34(18(3)4,19(5)6)13-12-21-14-23(29-24-22(21)16-28-26(31-24)33-7)30-25(32)27-15-20-10-8-9-11-20/h14,16-20H,8-11,15H2,1-7H3,(H2,27,28,29,30,31,32) |
| InChIKey | UFSKXFTYDZQIBY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|