C15H20N6O — CID 141037416
1-(2-amino-5-methylpyrido[2,3-d]pyrimidin-7-yl)-3-cyclohexylurea (PubChem CID 141037416) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 1-(2-amino-5-methylpyrido[2,3-d]pyrimidin-7-yl)-3-cyclohexylurea.
| Compound Name | 1-(2-amino-5-methylpyrido[2,3-d]pyrimidin-7-yl)-3-cyclohexylurea |
|---|---|
| PubChem CID | 141037416 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-(2-amino-5-methylpyrido[2,3-d]pyrimidin-7-yl)-3-cyclohexylurea |
| SMILES | Cc1cc(NC(=O)NC2CCCCC2)nc2nc(N)ncc12 |
| InChI | InChI=1S/C15H20N6O/c1-9-7-12(19-13-11(9)8-17-14(16)21-13)20-15(22)18-10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3,(H4,16,17,18,19,20,21,22) |
| InChIKey | YCIYBWCDUULAMH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |