C13H15N5O — CID 141037409
1-cyclopentyl-3-pyrido[2,3-d]pyrimidin-7-ylurea (PubChem CID 141037409) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-cyclopentyl-3-pyrido[2,3-d]pyrimidin-7-ylurea.
| Compound Name | 1-cyclopentyl-3-pyrido[2,3-d]pyrimidin-7-ylurea |
|---|---|
| PubChem CID | 141037409 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-cyclopentyl-3-pyrido[2,3-d]pyrimidin-7-ylurea |
| SMILES | O=C(Nc1ccc2cncnc2n1)NC1CCCC1 |
| InChI | InChI=1S/C13H15N5O/c19-13(16-10-3-1-2-4-10)18-11-6-5-9-7-14-8-15-12(9)17-11/h5-8,10H,1-4H2,(H2,14,15,16,17,18,19) |
| InChIKey | SBJHBUBYSWDAKG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |