C19H29N5O2 — CID 4149033
1-cyclohexyl-3-[6-(cyclohexylcarbamoylamino)-2-pyridinyl]urea (PubChem CID 4149033) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-(cyclohexylcarbamoylamino)-2-pyridinyl]urea.
| Compound Name | 1-cyclohexyl-3-[6-(cyclohexylcarbamoylamino)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 4149033 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 1-cyclohexyl-3-[6-(cyclohexylcarbamoylamino)-2-pyridinyl]urea |
| SMILES | O=C(Nc1cccc(NC(=O)NC2CCCCC2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C19H29N5O2/c25-18(20-14-8-3-1-4-9-14)23-16-12-7-13-17(22-16)24-19(26)21-15-10-5-2-6-11-15/h7,12-15H,1-6,8-11H2,(H4,20,21,22,23,24,25,26) |
| InChIKey | SGYOFTPOGOBISN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |