C31H51N7 — CID 102321701
1,2-dicyclohexyl-3-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-pyridinyl]guanidine (PubChem CID 102321701) has the molecular formula C31H51N7 and a molecular weight of 521.80 g/mol. Its IUPAC name is 1,2-dicyclohexyl-3-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-pyridinyl]guanidine.
| Compound Name | 1,2-dicyclohexyl-3-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 102321701 |
| Molecular Formula | C31H51N7 |
| Molecular Weight | 521.80 g/mol |
| Exact Mass | 521.42 |
| IUPAC Name | 1,2-dicyclohexyl-3-[6-[(N,N'-dicyclohexylcarbamimidoyl)amino]-2-pyridinyl]guanidine |
| SMILES | c1cc(N/C(=N/C2CCCCC2)NC2CCCCC2)nc(N/C(=N/C2CCCCC2)NC2CCCCC2)c1 |
| InChI | InChI=1S/C31H51N7/c1-5-14-24(15-6-1)32-30(33-25-16-7-2-8-17-25)37-28-22-13-23-29(36-28)38-31(34-26-18-9-3-10-19-26)35-27-20-11-4-12-21-27/h13,22-27H,1-12,14-21H2,(H4,32,33,34,35,36,37,38) |
| InChIKey | ACGCMPFQECMJBV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.80 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|