C25H27Cl2N5 — CID 118470414
1-[1-(2-chlorophenyl)-5-(4-chlorophenyl)pyrazol-3-yl]-3-cyclohexyl-2-cyclopropylguanidine (PubChem CID 118470414) has the molecular formula C25H27Cl2N5 and a molecular weight of 468.43 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)-5-(4-chlorophenyl)pyrazol-3-yl]-3-cyclohexyl-2-cyclopropylguanidine.
| Compound Name | 1-[1-(2-chlorophenyl)-5-(4-chlorophenyl)pyrazol-3-yl]-3-cyclohexyl-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 118470414 |
| Molecular Formula | C25H27Cl2N5 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-[1-(2-chlorophenyl)-5-(4-chlorophenyl)pyrazol-3-yl]-3-cyclohexyl-2-cyclopropylguanidine |
| SMILES | Clc1ccc(-c2cc(N/C(=N/C3CC3)NC3CCCCC3)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H27Cl2N5/c26-18-12-10-17(11-13-18)23-16-24(31-32(23)22-9-5-4-8-21(22)27)30-25(29-20-14-15-20)28-19-6-2-1-3-7-19/h4-5,8-13,16,19-20H,1-3,6-7,14-15H2,(H2,28,29,30,31) |
| InChIKey | JVKWUQVWOZZLOE-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|