C22H21Cl2N3O2S — CID 66862919
1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methoxy-N-(thian-4-yl)pyrazole-3-carboxamide (PubChem CID 66862919) has the molecular formula C22H21Cl2N3O2S and a molecular weight of 462.40 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methoxy-N-(thian-4-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methoxy-N-(thian-4-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 66862919 |
| Molecular Formula | C22H21Cl2N3O2S |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-methoxy-N-(thian-4-yl)pyrazole-3-carboxamide |
| SMILES | COc1c(C(=O)NC2CCSCC2)nn(-c2ccccc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O2S/c1-29-21-19(22(28)25-16-10-12-30-13-11-16)26-27(18-5-3-2-4-17(18)24)20(21)14-6-8-15(23)9-7-14/h2-9,16H,10-13H2,1H3,(H,25,28) |
| InChIKey | YXAXHFJHMOMOFL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |