C25H28Cl2N6O3 — CID 66863165
1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-[2-(ethylcarbamoylamino)ethoxy]-N-pyrrolidin-1-ylpyrazole-3-carboxamide (PubChem CID 66863165) has the molecular formula C25H28Cl2N6O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-[2-(ethylcarbamoylamino)ethoxy]-N-pyrrolidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-[2-(ethylcarbamoylamino)ethoxy]-N-pyrrolidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 66863165 |
| Molecular Formula | C25H28Cl2N6O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(4-chlorophenyl)-4-[2-(ethylcarbamoylamino)ethoxy]-N-pyrrolidin-1-ylpyrazole-3-carboxamide |
| SMILES | CCNC(=O)NCCOc1c(C(=O)NN2CCCC2)nn(-c2ccccc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H28Cl2N6O3/c1-2-28-25(35)29-13-16-36-23-21(24(34)31-32-14-5-6-15-32)30-33(20-8-4-3-7-19(20)27)22(23)17-9-11-18(26)12-10-17/h3-4,7-12H,2,5-6,13-16H2,1H3,(H,31,34)(H2,28,29,35) |
| InChIKey | ZDSBVGULFYUNNF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|