C23H24Cl2N6O2 — CID 25024108
4-[(2Z)-2-amino-2-hydroxyiminoethyl]-1-(2-chlorophenyl)-5-(4-chlorophenyl)-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 25024108) has the molecular formula C23H24Cl2N6O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is 4-[(2Z)-2-amino-2-hydroxyiminoethyl]-1-(2-chlorophenyl)-5-(4-chlorophenyl)-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 4-[(2Z)-2-amino-2-hydroxyiminoethyl]-1-(2-chlorophenyl)-5-(4-chlorophenyl)-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25024108 |
| Molecular Formula | C23H24Cl2N6O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 4-[(2Z)-2-amino-2-hydroxyiminoethyl]-1-(2-chlorophenyl)-5-(4-chlorophenyl)-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | N/C(Cc1c(C(=O)NN2CCCCC2)nn(-c2ccccc2Cl)c1-c1ccc(Cl)cc1)=N\O |
| InChI | InChI=1S/C23H24Cl2N6O2/c24-16-10-8-15(9-11-16)22-17(14-20(26)29-33)21(23(32)28-30-12-4-1-5-13-30)27-31(22)19-7-3-2-6-18(19)25/h2-3,6-11,33H,1,4-5,12-14H2,(H2,26,29)(H,28,32) |
| InChIKey | QJUDXSNINJURLI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|