C20H29Cl2N3O — CID 139721180
1,2-dicyclohexyl-3-(3,5-dichloro-4-methoxyphenyl)guanidine (PubChem CID 139721180) has the molecular formula C20H29Cl2N3O and a molecular weight of 398.38 g/mol. Its IUPAC name is 1,2-dicyclohexyl-3-(3,5-dichloro-4-methoxyphenyl)guanidine.
| Compound Name | 1,2-dicyclohexyl-3-(3,5-dichloro-4-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 139721180 |
| Molecular Formula | C20H29Cl2N3O |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1,2-dicyclohexyl-3-(3,5-dichloro-4-methoxyphenyl)guanidine |
| SMILES | COc1c(Cl)cc(N/C(=N/C2CCCCC2)NC2CCCCC2)cc1Cl |
| InChI | InChI=1S/C20H29Cl2N3O/c1-26-19-17(21)12-16(13-18(19)22)25-20(23-14-8-4-2-5-9-14)24-15-10-6-3-7-11-15/h12-15H,2-11H2,1H3,(H2,23,24,25) |
| InChIKey | MAUXMRHTUQGHBR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|