C20H28N3O2- — CID 163926985
4-[(N,N'-dicyclohexylcarbamimidoyl)amino]benzoate (PubChem CID 163926985) has the molecular formula C20H28N3O2- and a molecular weight of 342.46 g/mol. Its IUPAC name is 4-[(N,N'-dicyclohexylcarbamimidoyl)amino]benzoate.
| Compound Name | 4-[(N,N'-dicyclohexylcarbamimidoyl)amino]benzoate |
|---|---|
| PubChem CID | 163926985 |
| Molecular Formula | C20H28N3O2- |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-[(N,N'-dicyclohexylcarbamimidoyl)amino]benzoate |
| SMILES | O=C([O-])c1ccc(N/C(=N/C2CCCCC2)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H29N3O2/c24-19(25)15-11-13-18(14-12-15)23-20(21-16-7-3-1-4-8-16)22-17-9-5-2-6-10-17/h11-14,16-17H,1-10H2,(H,24,25)(H2,21,22,23)/p-1 |
| InChIKey | OPCAHQDXPFIDHR-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|