C15H23N5O — CID 116511348
N-[4-[(N-amino-N'-cyclohexylcarbamimidoyl)amino]phenyl]acetamide (PubChem CID 116511348) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[4-[(N-amino-N'-cyclohexylcarbamimidoyl)amino]phenyl]acetamide.
| Compound Name | N-[4-[(N-amino-N'-cyclohexylcarbamimidoyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 116511348 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-[4-[(N-amino-N'-cyclohexylcarbamimidoyl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N/C(=N/C2CCCCC2)NN)cc1 |
| InChI | InChI=1S/C15H23N5O/c1-11(21)17-13-7-9-14(10-8-13)19-15(20-16)18-12-5-3-2-4-6-12/h7-10,12H,2-6,16H2,1H3,(H,17,21)(H2,18,19,20) |
| InChIKey | SPMVDTOTQZFFQF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|