C14H21N5O — CID 116512225
N-[3-[(N-amino-N'-cyclopentylcarbamimidoyl)amino]phenyl]acetamide (PubChem CID 116512225) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[3-[(N-amino-N'-cyclopentylcarbamimidoyl)amino]phenyl]acetamide.
| Compound Name | N-[3-[(N-amino-N'-cyclopentylcarbamimidoyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 116512225 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-[3-[(N-amino-N'-cyclopentylcarbamimidoyl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N/C(=N/C2CCCC2)NN)c1 |
| InChI | InChI=1S/C14H21N5O/c1-10(20)16-12-7-4-8-13(9-12)18-14(19-15)17-11-5-2-3-6-11/h4,7-9,11H,2-3,5-6,15H2,1H3,(H,16,20)(H2,17,18,19) |
| InChIKey | AJLKOMVWKSNQMX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|