C12H17ClN4 — CID 116512323
1-amino-3-(4-chlorophenyl)-2-cyclopentylguanidine (PubChem CID 116512323) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is 1-amino-3-(4-chlorophenyl)-2-cyclopentylguanidine.
| Compound Name | 1-amino-3-(4-chlorophenyl)-2-cyclopentylguanidine |
|---|---|
| PubChem CID | 116512323 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-amino-3-(4-chlorophenyl)-2-cyclopentylguanidine |
| SMILES | NN/C(=N\C1CCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClN4/c13-9-5-7-11(8-6-9)16-12(17-14)15-10-3-1-2-4-10/h5-8,10H,1-4,14H2,(H2,15,16,17) |
| InChIKey | CBFVIFJSIAOQAR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|