C13H19ClN4 — CID 116511707
1-amino-3-(3-chloro-2-methylphenyl)-2-cyclopentylguanidine (PubChem CID 116511707) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is 1-amino-3-(3-chloro-2-methylphenyl)-2-cyclopentylguanidine.
| Compound Name | 1-amino-3-(3-chloro-2-methylphenyl)-2-cyclopentylguanidine |
|---|---|
| PubChem CID | 116511707 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-amino-3-(3-chloro-2-methylphenyl)-2-cyclopentylguanidine |
| SMILES | Cc1c(Cl)cccc1N/C(=N/C1CCCC1)NN |
| InChI | InChI=1S/C13H19ClN4/c1-9-11(14)7-4-8-12(9)17-13(18-15)16-10-5-2-3-6-10/h4,7-8,10H,2-3,5-6,15H2,1H3,(H2,16,17,18) |
| InChIKey | UNENFJNFBYSUTI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|