C13H18ClN3 — CID 107099700
N-amino-3-chloro-N'-cyclopentyl-2-methylbenzenecarboximidamide (PubChem CID 107099700) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-amino-3-chloro-N'-cyclopentyl-2-methylbenzenecarboximidamide.
| Compound Name | N-amino-3-chloro-N'-cyclopentyl-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107099700 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-amino-3-chloro-N'-cyclopentyl-2-methylbenzenecarboximidamide |
| SMILES | Cc1c(Cl)cccc1/C(=N/C1CCCC1)NN |
| InChI | InChI=1S/C13H18ClN3/c1-9-11(7-4-8-12(9)14)13(17-15)16-10-5-2-3-6-10/h4,7-8,10H,2-3,5-6,15H2,1H3,(H,16,17) |
| InChIKey | ICVIRCDXTUGGLQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|