C13H17BrClN3 — CID 81307820
N-amino-4-bromo-3-chloro-N'-cyclohexylbenzenecarboximidamide (PubChem CID 81307820) has the molecular formula C13H17BrClN3 and a molecular weight of 330.66 g/mol. Its IUPAC name is N-amino-4-bromo-3-chloro-N'-cyclohexylbenzenecarboximidamide.
| Compound Name | N-amino-4-bromo-3-chloro-N'-cyclohexylbenzenecarboximidamide |
|---|---|
| PubChem CID | 81307820 |
| Molecular Formula | C13H17BrClN3 |
| Molecular Weight | 330.66 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-amino-4-bromo-3-chloro-N'-cyclohexylbenzenecarboximidamide |
| SMILES | NN/C(=N\C1CCCCC1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C13H17BrClN3/c14-11-7-6-9(8-12(11)15)13(18-16)17-10-4-2-1-3-5-10/h6-8,10H,1-5,16H2,(H,17,18) |
| InChIKey | HBKCBVPMQWYRBS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|