C10H13Br2N3S — CID 80538881
N-amino-4,5-dibromo-N'-cyclopentylthiophene-2-carboximidamide (PubChem CID 80538881) has the molecular formula C10H13Br2N3S and a molecular weight of 367.11 g/mol. Its IUPAC name is N-amino-4,5-dibromo-N'-cyclopentylthiophene-2-carboximidamide.
| Compound Name | N-amino-4,5-dibromo-N'-cyclopentylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 80538881 |
| Molecular Formula | C10H13Br2N3S |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | N-amino-4,5-dibromo-N'-cyclopentylthiophene-2-carboximidamide |
| SMILES | NN/C(=N\C1CCCC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H13Br2N3S/c11-7-5-8(16-9(7)12)10(15-13)14-6-3-1-2-4-6/h5-6H,1-4,13H2,(H,14,15) |
| InChIKey | GZGAHGWATKDACN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|