C11H15N3S2 — CID 81261860
N-amino-N'-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide (PubChem CID 81261860) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is N-amino-N'-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide.
| Compound Name | N-amino-N'-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide |
|---|---|
| PubChem CID | 81261860 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-amino-N'-cyclopropyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide |
| SMILES | NN/C(=N\C1CC1)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C11H15N3S2/c12-14-11(13-8-1-2-8)10-5-7-6-15-4-3-9(7)16-10/h5,8H,1-4,6,12H2,(H,13,14) |
| InChIKey | LNJFGUSGXZGCLS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|