C8H7ClOS2 — CID 81260755
6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carbonyl chloride (PubChem CID 81260755) has the molecular formula C8H7ClOS2 and a molecular weight of 218.73 g/mol. Its IUPAC name is 6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carbonyl chloride.
| Compound Name | 6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carbonyl chloride |
|---|---|
| PubChem CID | 81260755 |
| Molecular Formula | C8H7ClOS2 |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 217.96 |
| IUPAC Name | 6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carbonyl chloride |
| SMILES | O=C(Cl)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C8H7ClOS2/c9-8(10)7-3-5-4-11-2-1-6(5)12-7/h3H,1-2,4H2 |
| InChIKey | NSKGJYUCNLUHMY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|