C14H20ClNOS2 — CID 114008438
N-(6-chlorohexyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 114008438) has the molecular formula C14H20ClNOS2 and a molecular weight of 317.91 g/mol. Its IUPAC name is N-(6-chlorohexyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-(6-chlorohexyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 114008438 |
| Molecular Formula | C14H20ClNOS2 |
| Molecular Weight | 317.91 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-(6-chlorohexyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | O=C(NCCCCCCCl)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C14H20ClNOS2/c15-6-3-1-2-4-7-16-14(17)13-9-11-10-18-8-5-12(11)19-13/h9H,1-8,10H2,(H,16,17) |
| InChIKey | YMJCBOOYOXOTBH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|