C15H20ClNOS2 — CID 114301654
N-[(2-chlorocyclohexyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 114301654) has the molecular formula C15H20ClNOS2 and a molecular weight of 329.92 g/mol. Its IUPAC name is N-[(2-chlorocyclohexyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-[(2-chlorocyclohexyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 114301654 |
| Molecular Formula | C15H20ClNOS2 |
| Molecular Weight | 329.92 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-[(2-chlorocyclohexyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1Cl)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C15H20ClNOS2/c16-12-4-2-1-3-10(12)8-17-15(18)14-7-11-9-19-6-5-13(11)20-14/h7,10,12H,1-6,8-9H2,(H,17,18) |
| InChIKey | IQBVRQQSXMIDFD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.92 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|