C17H24BrNOS — CID 114317527
N-[[2-(bromomethyl)cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 114317527) has the molecular formula C17H24BrNOS and a molecular weight of 370.36 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114317527 |
| Molecular Formula | C17H24BrNOS |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[[2-(bromomethyl)cyclohexyl]methyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCCC1CBr)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C17H24BrNOS/c18-10-13-6-1-2-7-14(13)11-19-17(20)16-9-12-5-3-4-8-15(12)21-16/h9,13-14H,1-8,10-11H2,(H,19,20) |
| InChIKey | UOGVTYCJNMJDAX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|