C15H20BrNOS2 — CID 114317282
N-[[2-(bromomethyl)cyclopentyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 114317282) has the molecular formula C15H20BrNOS2 and a molecular weight of 374.37 g/mol. Its IUPAC name is N-[[2-(bromomethyl)cyclopentyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-[[2-(bromomethyl)cyclopentyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 114317282 |
| Molecular Formula | C15H20BrNOS2 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-[[2-(bromomethyl)cyclopentyl]methyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | O=C(NCC1CCCC1CBr)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C15H20BrNOS2/c16-7-10-2-1-3-11(10)8-17-15(18)14-6-12-9-19-5-4-13(12)20-14/h6,10-11H,1-5,7-9H2,(H,17,18) |
| InChIKey | HRVGFCKRBMMLCK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|