C13H18BrNO2S2 — CID 106307464
N-[3-(2-bromoethoxy)propyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 106307464) has the molecular formula C13H18BrNO2S2 and a molecular weight of 364.33 g/mol. Its IUPAC name is N-[3-(2-bromoethoxy)propyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-[3-(2-bromoethoxy)propyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 106307464 |
| Molecular Formula | C13H18BrNO2S2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-[3-(2-bromoethoxy)propyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | O=C(NCCCOCCBr)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C13H18BrNO2S2/c14-3-6-17-5-1-4-15-13(16)12-8-10-9-18-7-2-11(10)19-12/h8H,1-7,9H2,(H,15,16) |
| InChIKey | GMCYQVCETUELDX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|