C14H18ClNOS2 — CID 114300741
N-[1-(chloromethyl)cyclopentyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 114300741) has the molecular formula C14H18ClNOS2 and a molecular weight of 315.89 g/mol. Its IUPAC name is N-[1-(chloromethyl)cyclopentyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-[1-(chloromethyl)cyclopentyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 114300741 |
| Molecular Formula | C14H18ClNOS2 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[1-(chloromethyl)cyclopentyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | O=C(NC1(CCl)CCCC1)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C14H18ClNOS2/c15-9-14(4-1-2-5-14)16-13(17)12-7-10-8-18-6-3-11(10)19-12/h7H,1-6,8-9H2,(H,16,17) |
| InChIKey | WPSLQUMBXKGXIU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|