C13H18ClNOS2 — CID 114305649
N-(1-chloro-3-methylbutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 114305649) has the molecular formula C13H18ClNOS2 and a molecular weight of 303.88 g/mol. Its IUPAC name is N-(1-chloro-3-methylbutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-(1-chloro-3-methylbutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 114305649 |
| Molecular Formula | C13H18ClNOS2 |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-(1-chloro-3-methylbutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | CC(C)C(CCl)NC(=O)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C13H18ClNOS2/c1-8(2)10(6-14)15-13(16)12-5-9-7-17-4-3-11(9)18-12/h5,8,10H,3-4,6-7H2,1-2H3,(H,15,16) |
| InChIKey | KXZSYLIVHVLNOQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|