C15H22ClNOS — CID 106354632
N-(1-chloro-4-methylpentan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 106354632) has the molecular formula C15H22ClNOS and a molecular weight of 299.87 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106354632 |
| Molecular Formula | C15H22ClNOS |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)C(CCCl)NC(=O)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C15H22ClNOS/c1-10(2)12(7-8-16)17-15(18)14-9-11-5-3-4-6-13(11)19-14/h9-10,12H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | FELPGJSQCYVGTR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|