C15H22BrNOS — CID 113276054
N-(5-bromopentan-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide (PubChem CID 113276054) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is N-(5-bromopentan-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide.
| Compound Name | N-(5-bromopentan-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113276054 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(5-bromopentan-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
| SMILES | CC(CCCBr)NC(=O)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C15H22BrNOS/c1-11(6-5-9-16)17-15(18)14-10-12-7-3-2-4-8-13(12)19-14/h10-11H,2-9H2,1H3,(H,17,18) |
| InChIKey | BYVKKZAYMWPMAW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|