C12H16N2OS3 — CID 81261986
N-(1-amino-1-sulfanylidenebutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 81261986) has the molecular formula C12H16N2OS3 and a molecular weight of 300.47 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenebutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 81261986 |
| Molecular Formula | C12H16N2OS3 |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | CCC(NC(=O)c1cc2c(s1)CCSC2)C(N)=S |
| InChI | InChI=1S/C12H16N2OS3/c1-2-8(11(13)16)14-12(15)10-5-7-6-17-4-3-9(7)18-10/h5,8H,2-4,6H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | KDYLUENFDDPUNG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|