C14H13NOS2 — CID 81261881
(4-aminophenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone (PubChem CID 81261881) has the molecular formula C14H13NOS2 and a molecular weight of 275.40 g/mol. Its IUPAC name is (4-aminophenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone.
| Compound Name | (4-aminophenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone |
|---|---|
| PubChem CID | 81261881 |
| Molecular Formula | C14H13NOS2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (4-aminophenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methanone |
| SMILES | Nc1ccc(C(=O)c2cc3c(s2)CCSC3)cc1 |
| InChI | InChI=1S/C14H13NOS2/c15-11-3-1-9(2-4-11)14(16)13-7-10-8-17-6-5-12(10)18-13/h1-4,7H,5-6,8,15H2 |
| InChIKey | VSDLEEBMDPISEZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|