C14H13FN2OS2 — CID 81269223
N-(2-amino-4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 81269223) has the molecular formula C14H13FN2OS2 and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 81269223 |
| Molecular Formula | C14H13FN2OS2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | Nc1cc(F)ccc1NC(=O)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C14H13FN2OS2/c15-9-1-2-11(10(16)6-9)17-14(18)13-5-8-7-19-4-3-12(8)20-13/h1-2,5-6H,3-4,7,16H2,(H,17,18) |
| InChIKey | ROPABSOLNAWZTG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|