C15H16N2O2S2 — CID 81266934
N-(2-amino-5-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide (PubChem CID 81266934) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 81266934 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboxamide |
| SMILES | COc1ccc(N)c(NC(=O)c2cc3c(s2)CCSC3)c1 |
| InChI | InChI=1S/C15H16N2O2S2/c1-19-10-2-3-11(16)12(7-10)17-15(18)14-6-9-8-20-5-4-13(9)21-14/h2-3,6-7H,4-5,8,16H2,1H3,(H,17,18) |
| InChIKey | PLXJWTHLBJZDPK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|