C15H23N3S2 — CID 81260693
N-amino-N'-cycloheptyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide (PubChem CID 81260693) has the molecular formula C15H23N3S2 and a molecular weight of 309.50 g/mol. Its IUPAC name is N-amino-N'-cycloheptyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide.
| Compound Name | N-amino-N'-cycloheptyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide |
|---|---|
| PubChem CID | 81260693 |
| Molecular Formula | C15H23N3S2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-amino-N'-cycloheptyl-6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-carboximidamide |
| SMILES | NN/C(=N\C1CCCCCC1)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C15H23N3S2/c16-18-15(17-12-5-3-1-2-4-6-12)14-9-11-10-19-8-7-13(11)20-14/h9,12H,1-8,10,16H2,(H,17,18) |
| InChIKey | SHOIZJOMUAYCOH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|