C11H17N3S — CID 61360915
N-amino-N'-cyclopentyl-5-methylthiophene-2-carboximidamide (PubChem CID 61360915) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is N-amino-N'-cyclopentyl-5-methylthiophene-2-carboximidamide.
| Compound Name | N-amino-N'-cyclopentyl-5-methylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 61360915 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-amino-N'-cyclopentyl-5-methylthiophene-2-carboximidamide |
| SMILES | Cc1ccc(/C(=N/C2CCCC2)NN)s1 |
| InChI | InChI=1S/C11H17N3S/c1-8-6-7-10(15-8)11(14-12)13-9-4-2-3-5-9/h6-7,9H,2-5,12H2,1H3,(H,13,14) |
| InChIKey | DSYBZJNMDVMXPO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|